Products 849062-08-4
CAS 849062-08-4 appears in our catalog under these names: 3-Methoxy-2,4,6-trifluorophenylboronic acid, 97%, (2,4,6-Trifluoro-3-methoxyphenyl)boronic acid 98%, 3-Methoxy-2,4,6-trifluorophenylboronic acid, 98%, 98%, (2,4,6-Trifluoro-3-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 250mg.
(2,4,6-Trifluoro-3-methoxyphenyl)boronic acid 98%
Ambeed- size: 250mg, 1g, 5g
- Variants: 3
from 275.81
(2,4,6-trifluoro-3-methoxyphenyl)boronic acid (CAS 849062-08-4) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: (2,4,6-trifluoro-3-methoxyphenyl)boronic acid. InChIKey: RDORBPOVXUMTLU-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | (2,4,6-trifluoro-3-methoxyphenyl)boronic acid |
| InChIKey | RDORBPOVXUMTLU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)OC)F)(O)O |
Computed by PubChem (NCBI)