Products 957062-66-7
CAS 957062-66-7 appears in our catalog under these names: 3-Hydroxy-5-(trifluoromethyl)phenylboronic acid, 98%, (3-Hydroxy-5-(trifluoromethyl)phenyl)boronic acid 98%, (3-Hydroxy-5-(trifluoromethyl)phenyl)boronic acid, 95%+, 95%+, (3-Hydroxy-5-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
[3-hydroxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 957062-66-7) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [3-hydroxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: KHBHZULNSZTOAL-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [3-hydroxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KHBHZULNSZTOAL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)