CAS 1072951-50-8 appears in our catalog under these names: 2-Hydroxy-4-trifluoromethylphenylboronic acid, 97%, (2-HYDROXY-4-(TRIFLUOROMETHYL)PHENYL)BORONIC ACID, 98%, 98%, (2-Hydroxy-4-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 250g, 500g, 1kg.
[2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid (CAS 1072951-50-8) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: GYGNUMOLFBSVCL-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [2-hydroxy-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GYGNUMOLFBSVCL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)