CAS 943918-05-6 appears in our catalog under these names: 4-Hydroxy-2-(trifluoromethyl)phenylboronic acid, 95%, 4-Hydroxy-2-(trifluoromethyl)phenylboronic acid, 98%, 98%, (4-Hydroxy-2-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
[4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 943918-05-6) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: MHKOVSRFDDLIFU-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [4-hydroxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MHKOVSRFDDLIFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)