cas: 1151-94-6 — see every product listed under this CAS number, including other names
(4-Methoxyphenyl)(4-nitrophenyl)methanone, 95-<97% (CAS 1151-94-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1865-95-97-10g |
| cas | 1151-94-6 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3268.32 Pln | |
| Hoffman Fine Chemicals | 25g | 7338.76 Pln | |
| Hoffman Fine Chemicals | 50g | 11555.94 Pln | |
| Hoffman Fine Chemicals | 100g | 18299.60 Pln | |
| Hoffman Fine Chemicals | 200g | 29100.94 Pln | |
| Hoffman Fine Chemicals | 300g | 37018.52 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
(4-methoxyphenyl)-(4-nitrophenyl)methanone (CAS 1151-94-6) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: (4-methoxyphenyl)-(4-nitrophenyl)methanone. InChIKey: DXVSAELNVPXMSQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | (4-methoxyphenyl)-(4-nitrophenyl)methanone |
| InChIKey | DXVSAELNVPXMSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)