CAS 380431-06-1 appears in our catalog under these names: Nicotinic acid 4-formyl-2-methoxy-phenyl ester, 95%, 4-Formyl-2-methoxyphenyl pyridine-3-carboxylate, 95%, 4-Formyl-2-methoxyphenyl pyridine-3-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 2,5g.
(4-formyl-2-methoxyphenyl) pyridine-3-carboxylate (CAS 380431-06-1) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) pyridine-3-carboxylate. InChIKey: NIEKGVVKLQOETF-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) pyridine-3-carboxylate |
| InChIKey | NIEKGVVKLQOETF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)