CAS 67565-48-4 appears in our catalog under these names: 4-(4-Nitrobenzyloxy)benzaldehyde, 95%, 4-(p-Nitrobenzyloxy)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 100g, 5g, 250mg, 500mg, 1000mg.
4-[(4-nitrophenyl)methoxy]benzaldehyde (CAS 67565-48-4) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 4-[(4-nitrophenyl)methoxy]benzaldehyde. InChIKey: RIYUFYPNHRLRON-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 4-[(4-nitrophenyl)methoxy]benzaldehyde |
| InChIKey | RIYUFYPNHRLRON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)