CAS 1261952-79-7 appears in our catalog under these names: 3-(2-Methylphenyl)-5-nitrobenzoic acid, 97%, 2'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid, 97%, 97%, 2'-Methyl-5-nitro-[1,1'-biphenyl]-3-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
3-(2-methylphenyl)-5-nitrobenzoic acid (CAS 1261952-79-7) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-(2-methylphenyl)-5-nitrobenzoic acid. InChIKey: SQUAMAPZYQSOBB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-(2-methylphenyl)-5-nitrobenzoic acid |
| InChIKey | SQUAMAPZYQSOBB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)