cas: 4160-63-8 — see every product listed under this CAS number, including other names
(4-Methoxyphenyl)(thiophen-2-yl)methanone, 98% (CAS 4160-63-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235912-1G |
| cas | 4160-63-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 25g | 1185.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4-methoxyphenyl)-thiophen-2-ylmethanone (CAS 4160-63-8) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: (4-methoxyphenyl)-thiophen-2-ylmethanone. InChIKey: KYVBFEMQEUXVQB-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | (4-methoxyphenyl)-thiophen-2-ylmethanone |
| InChIKey | KYVBFEMQEUXVQB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)