CAS 17595-85-6 is the registry number for Methyl 3-(2-thienyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-thiophen-2-ylbenzoate (CAS 17595-85-6) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: methyl 3-thiophen-2-ylbenzoate. InChIKey: MTYCPVXBEPSDOY-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | methyl 3-thiophen-2-ylbenzoate |
| InChIKey | MTYCPVXBEPSDOY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)