cas: 874959-97-4 — see every product listed under this CAS number, including other names
(4-Methoxypyridin-3-yl)boronic acid hydrochloride 98% (CAS 874959-97-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A565116-250mg |
| cas | 874959-97-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 10g | 1260.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A565116 |
(4-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 874959-97-4) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (4-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: JLONCHBPEIKTEA-UHFFFAOYSA-N.
| Molecular formula | C6H9BClNO3 |
|---|---|
| Molecular weight | 189.41 g/mol |
| IUPAC name | (4-methoxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | JLONCHBPEIKTEA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)OC)(O)O.Cl |
Computed by PubChem (NCBI)