cas: 874959-97-4 — see every product listed under this CAS number, including other names
(4-Methoxypyridin-3-yl)boronic acid hydrochloride, 96%, 96% (CAS 874959-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A9F-100mg |
| cas | 874959-97-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 779.60 Pln | |
| Chemat | 10g | 1494.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(4-methoxy-3-pyridinyl)boronic acid;hydrochloride (CAS 874959-97-4) is a chemical compound with the molecular formula C6H9BClNO3 and a molecular weight of 189.41 g/mol. IUPAC name: (4-methoxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: JLONCHBPEIKTEA-UHFFFAOYSA-N.
| Molecular formula | C6H9BClNO3 |
|---|---|
| Molecular weight | 189.41 g/mol |
| IUPAC name | (4-methoxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | JLONCHBPEIKTEA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)OC)(O)O.Cl |
Computed by PubChem (NCBI)