cas: 32857-63-9 — see every product listed under this CAS number, including other names
(4-tert-Butylphenyl)acetic acid, 97% (CAS 32857-63-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302693-5G |
| cas | 32857-63-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 466.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-tert-butylphenyl)acetic acid (CAS 32857-63-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-(4-tert-butylphenyl)acetic acid. InChIKey: RUAYXHSDAMWEDR-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)acetic acid |
| InChIKey | RUAYXHSDAMWEDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)