cas: 32857-63-9 — see every product listed under this CAS number, including other names
2-(4-(tert-Butyl)phenyl)acetic acid, 98%, 98% (CAS 32857-63-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11456F-1g |
| cas | 32857-63-9 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 500g | 1238.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-tert-butylphenyl)acetic acid (CAS 32857-63-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-(4-tert-butylphenyl)acetic acid. InChIKey: RUAYXHSDAMWEDR-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)acetic acid |
| InChIKey | RUAYXHSDAMWEDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)