Products 32857-63-9
CAS 32857-63-9 appears in our catalog under these names: 4-tert-Butylphenylacetic acid, 98%, 4–tert–Butylphenylacetic Acid, 4-tert-Butylphenylacetic Acid, >98.0%(GC)(T), 2-(4-(tert-Butyl)phenyl)acetic acid 98%, 2-(4-(tert-Butyl)phenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 250mg, 10g.
2-(4-tert-butylphenyl)acetic acid (CAS 32857-63-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 2-(4-tert-butylphenyl)acetic acid. InChIKey: RUAYXHSDAMWEDR-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)acetic acid |
| InChIKey | RUAYXHSDAMWEDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butylphenylacetic acid, Benzeneacetic acid, 4-(1,1-dimethylethyl)-, 4-(1,1-Dimethylethyl)benzeneacetic acid, (4-tert-Butylphenyl)acetic acid, 2-(4-(tert-Butyl)phenyl)acetic acid, 2-(4-tert-butylphenyl)acetic acid, 4-t-Butylphenylacetic acid, (p-tert-Butylphenyl)acetic acid, (4-tert-Butyl-phenyl)-acetic acid, Fenazaquin metabolite NN6