cas: 110351-94-5 — see every product listed under this CAS number, including other names
(4S)-4-Ethyl-7,8-dihydro-4-hydroxy-1H-pyrano[3,4-f]indolizine-3,6,10(4H)-trione, 99%, 99% (CAS 110351-94-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11499O-50mg |
| cas | 110351-94-5 |
| size | 50mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 500mg | 198.80 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1994.00 Pln | |
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 50g | 6952.40 Pln | |
| Chemat | 100g | 8915.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione (CAS 110351-94-5) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: (4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione. InChIKey: IGKWOGMVAOYVSJ-ZDUSSCGKSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | (4S)-4-ethyl-4-hydroxy-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10-trione |
| InChIKey | IGKWOGMVAOYVSJ-ZDUSSCGKSA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2)O |
Computed by PubChem (NCBI)