CAS 142962-04-7 appears in our catalog under these names: 1-[(2H-1,3-Benzodioxol-5-yl)carbonyl]pyrrolidine-2-carboxylic acid, 95%, (Benzo(d)(1,3)dioxole-5-carbonyl)proline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid (CAS 142962-04-7) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid. InChIKey: PTNAENHSKZUBGX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | PTNAENHSKZUBGX-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)