CAS 84209-07-4 is the registry number for Methyl 2-(1,3-dioxo-1,3-dihydro-2-isoindolyloxy)-2-methylpropionate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate (CAS 84209-07-4) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: methyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate. InChIKey: QWDDJKIVBMVIKV-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | methyl 2-(1,3-dioxoisoindol-2-yl)oxy-2-methylpropanoate |
| InChIKey | QWDDJKIVBMVIKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)