CAS 705268-13-9 appears in our catalog under these names: 2-(3-Methoxypropyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(3-Methoxypropyl)-1,3-dioxoisoindoline-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 705268-13-9) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: FDOUOUHZOGGPIV-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | FDOUOUHZOGGPIV-UHFFFAOYSA-N |
| SMILES | COCCCN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)