CAS 80953-62-4 appears in our catalog under these names: 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(phenylmethyl) ester, 95%, 1-((Benzyloxy)carbonyl)-5-oxopyrrolidine-2-carboxylic acid, Cbz-DL-Pyr-OH 98%, 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(phenylmethyl) ester, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 80953-62-4) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: VHSFUGXCSGOKJX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 5-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | VHSFUGXCSGOKJX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)