(4aS,7aS)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride, 95%
cas: 1660110-86-0 — see every product listed under this CAS number, including other names
(4aS,7aS)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride, 95% (CAS 1660110-86-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F868389-100MG |
| cas | 1660110-86-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1960.79 Pln | |
| Fluorochem | 250mg | 3824.71 Pln | |
| Fluorochem | 1g | 11082.57 Pln | |
| Ambeed | 250mg | 3835.81 Pln | |
| Ambeed | 1g | 11378.56 Pln | |
| Chemat | 50mg | 832.40 Pln | |
| Chemat | 100mg | 1365.20 Pln | |
| Chemat | 250mg | 2666.00 Pln | |
| Chemat | 1g | 7878.80 Pln | |
| BLDpharm | 50mg | 1158.51 Pln | |
| BLDpharm | 100mg | 1919.35 Pln | |
| BLDpharm | 250mg | 3763.14 Pln | |
| BLDpharm | 1g | 11149.43 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (CAS 1660110-86-0) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride. InChIKey: JWEHBYVWAVHAEP-LEUCUCNGSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| InChIKey | JWEHBYVWAVHAEP-LEUCUCNGSA-N |
| SMILES | C1C[C@H]2[C@H](C1)OCCN2.Cl |
Computed by PubChem (NCBI)