Products 1660110-86-0
CAS 1660110-86-0 appears in our catalog under these names: (4aS,7aS)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride 95%, (4aS,7aS)-Octahydrocyclopenta[b][1,4]oxazine Hydrochloride, 95%, 95%, (4aS,7aS)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (CAS 1660110-86-0) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride. InChIKey: JWEHBYVWAVHAEP-LEUCUCNGSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| InChIKey | JWEHBYVWAVHAEP-LEUCUCNGSA-N |
| SMILES | C1C[C@H]2[C@H](C1)OCCN2.Cl |
Computed by PubChem (NCBI)