CAS 1820580-89-9 appears in our catalog under these names: (4aR,7aS)-Octahydrocyclopenta(b)morpholine hydrochloride, (4aR,7aS)-octahydrocyclopenta[b]morpholine hydrochloride, 97%, 97%, (4aR,7aS)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (CAS 1820580-89-9) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride. InChIKey: JWEHBYVWAVHAEP-HHQFNNIRSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (4aR,7aS)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| InChIKey | JWEHBYVWAVHAEP-HHQFNNIRSA-N |
| SMILES | C1C[C@@H]2[C@H](C1)OCCN2.Cl |
Computed by PubChem (NCBI)