CAS 1616436-40-8 is the registry number for rel-(4aR,7aR)-Octahydrocyclopenta[b][1,4]oxazine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (CAS 1616436-40-8) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride. InChIKey: JWEHBYVWAVHAEP-ZJLYAJKPSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (4aR,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| InChIKey | JWEHBYVWAVHAEP-ZJLYAJKPSA-N |
| SMILES | C1C[C@@H]2[C@@H](C1)OCCN2.Cl |
Computed by PubChem (NCBI)