CAS 1807941-05-4 appears in our catalog under these names: rel-(4aS,7aR)-Octahydrocyclopenta(b)(1,4)oxazine hydrochloride, 98%, rac-(4aR,7aS)-Octahydrocyclopenta(b)morpholine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride (CAS 1807941-05-4) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride. InChIKey: JWEHBYVWAVHAEP-UOERWJHTSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (4aS,7aR)-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine;hydrochloride |
| InChIKey | JWEHBYVWAVHAEP-UOERWJHTSA-N |
| SMILES | C1C[C@H]2[C@@H](C1)OCCN2.Cl |
Computed by PubChem (NCBI)