cas: 73069-13-3 — see every product listed under this CAS number, including other names
(4aS,8aS)-3,8a-Dimethyl-5-methylene-4a,5,6,7,8,8a-hexahydronaphtho[2,3-b]furan-2(4H)-one, 99%, 99% (CAS 73069-13-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 10mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAFP-25mg |
| cas | 73069-13-3 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 1158.80 Pln | |
| Chemat | 10mg | 587.60 Pln | |
| Chemat | 50mg | 1845.20 Pln | |
| Chemat | 100mg | 3506.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one (CAS 73069-13-3) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one. InChIKey: ZTVSGQPHMUYCRS-SWLSCSKDSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| InChIKey | ZTVSGQPHMUYCRS-SWLSCSKDSA-N |
| SMILES | CC1=C2C[C@H]3C(=C)CCC[C@@]3(C=C2OC1=O)C |
Computed by PubChem (NCBI)