Products 73069-13-3
CAS 73069-13-3 appears in our catalog under these names: Atractylenolide i, 95%, Atractylenolide I, Atractylenolide I/ 97.55% (existing batch purity), AtractylenolideI, ATRACTYLENOLIDE I FROM ATRACTYLODES&. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 20mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
(4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one (CAS 73069-13-3) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: (4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one. InChIKey: ZTVSGQPHMUYCRS-SWLSCSKDSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | (4aS,8aS)-3,8a-dimethyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| InChIKey | ZTVSGQPHMUYCRS-SWLSCSKDSA-N |
| SMILES | CC1=C2C[C@H]3C(=C)CCC[C@@]3(C=C2OC1=O)C |
Computed by PubChem (NCBI)