Products 261919-95-3
CAS 261919-95-3 is the registry number for 2-(4-tert-Butylphenyl)-1,3-cyclopentanedione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(4-tert-butylphenyl)cyclopentane-1,3-dione (CAS 261919-95-3) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 2-(4-tert-butylphenyl)cyclopentane-1,3-dione. InChIKey: CIGZGTVSEDTFHQ-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)cyclopentane-1,3-dione |
| InChIKey | CIGZGTVSEDTFHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2C(=O)CCC2=O |
Computed by PubChem (NCBI)