Products 65805-80-3

CAS 65805-80-3 is the registry number for 1,2,3,4,5,6,7,8-Octahydrophenanthrene-9-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carboxylic acid (CAS 65805-80-3) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carboxylic acid. InChIKey: RXYPAUUNBPXTNH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18O2
Molecular weight230.30 g/mol
IUPAC name1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carboxylic acid
InChIKeyRXYPAUUNBPXTNH-UHFFFAOYSA-N
SMILESC1CCC2=C3CCCCC3=C(C=C2C1)C(=O)O

Computed by PubChem (NCBI)