CAS 64959-16-6 is the registry number for 3-Cyclohexylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclohexylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid (CAS 64959-16-6) is a chemical compound with the molecular formula C15H18O2 and a molecular weight of 230.30 g/mol. IUPAC name: 3-cyclohexylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid. InChIKey: HJZOSFDHVMWXOL-UHFFFAOYSA-N.
| Molecular formula | C15H18O2 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | 3-cyclohexylbicyclo[4.2.0]octa-1(6),2,4-triene-7-carboxylic acid |
| InChIKey | HJZOSFDHVMWXOL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC3=C(C=C2)C(C3)C(=O)O |
Computed by PubChem (NCBI)