cas: 617689-07-3 — see every product listed under this CAS number, including other names
(5–Methoxy–2–methylphenyl)boronic acid(contains varying amounts of Anhydride) (CAS 617689-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 25mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD17797-100mg |
| cas | 617689-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 685.97 Pln | |
| GLPBio | 1g | 1495.70 Pln | |
| GLPBio | 250mg | 802.98 Pln | |
| GLPBio | 25mg | 564.28 Pln | |
| GLPBio | 5g | 3878.07 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(5-methoxy-2-methylphenyl)boronic acid (CAS 617689-07-3) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (5-methoxy-2-methylphenyl)boronic acid. InChIKey: QUQJFILPCCJEGB-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (5-methoxy-2-methylphenyl)boronic acid |
| InChIKey | QUQJFILPCCJEGB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)