cas: 617689-07-3 — see every product listed under this CAS number, including other names
(5-Methoxy-2-methylphenyl)boronic acid, 95% (CAS 617689-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219653-100MG |
| cas | 617689-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2314.83 Pln | |
| Fluorochem | 10g | 4569.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(5-methoxy-2-methylphenyl)boronic acid (CAS 617689-07-3) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (5-methoxy-2-methylphenyl)boronic acid. InChIKey: QUQJFILPCCJEGB-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (5-methoxy-2-methylphenyl)boronic acid |
| InChIKey | QUQJFILPCCJEGB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)