cas: 871332-99-9 — see every product listed under this CAS number, including other names
(5-(N,N-Dimethylsulfamoyl)-2-methylphenyl)boronic acid 95% (CAS 871332-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A510036-250mg |
| cas | 871332-99-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3413.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A510036 |
[5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid (CAS 871332-99-9) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid. InChIKey: ISKRAODOAGHCKV-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid |
| InChIKey | ISKRAODOAGHCKV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N(C)C)C)(O)O |
Computed by PubChem (NCBI)