CAS 1072945-64-2 is the registry number for 3-(Propylsulfonamido)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(propylsulfonylamino)phenyl]boronic acid (CAS 1072945-64-2) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [3-(propylsulfonylamino)phenyl]boronic acid. InChIKey: JZIHQVMLJAJFFZ-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [3-(propylsulfonylamino)phenyl]boronic acid |
| InChIKey | JZIHQVMLJAJFFZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NS(=O)(=O)CCC)(O)O |
Computed by PubChem (NCBI)