CAS 957034-82-1 appears in our catalog under these names: 4-(N,N-Dimethylsulfamoyl)-2-methylphenylboronic acid, 98%, (4-(N,N-Dimethylsulfamoyl)-2-methylphenyl)boronic acid 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[4-(dimethylsulfamoyl)-2-methylphenyl]boronic acid (CAS 957034-82-1) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [4-(dimethylsulfamoyl)-2-methylphenyl]boronic acid. InChIKey: KNKDICZGYPFTBK-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [4-(dimethylsulfamoyl)-2-methylphenyl]boronic acid |
| InChIKey | KNKDICZGYPFTBK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)N(C)C)C)(O)O |
Computed by PubChem (NCBI)