CAS 871332-99-9 appears in our catalog under these names: N,N-Dimethyl 3-borono-4-methylbenzenesulfonamide, 98%, (5-(N,N-Dimethylsulfamoyl)-2-methylphenyl)boronic acid 95%, (5-(N,N-Dimethylsulfamoyl)-2-methylphenyl)boronic acid, 95%, 95%, (5-(N,N-Dimethylsulfamoyl)-2-methylphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid (CAS 871332-99-9) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid. InChIKey: ISKRAODOAGHCKV-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [5-(dimethylsulfamoyl)-2-methylphenyl]boronic acid |
| InChIKey | ISKRAODOAGHCKV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N(C)C)C)(O)O |
Computed by PubChem (NCBI)