CAS 196809-85-5 appears in our catalog under these names: (4-(N-Propylsulfamoyl)phenyl)boronic acid, 95%, (4-(N-Propylsulfamoyl)phenyl)boronic acid, 98%, (4–((propylamino)sulfonyl)phenyl)Boronic acid, (4-(N-propylsulfamoyl)phenyl)boronic acid, 95%, 95%, [4-[(PROPYLAMINO)SULFONYL]PHENYL]BORONIC ACID, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
[4-(propylsulfamoyl)phenyl]boronic acid (CAS 196809-85-5) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [4-(propylsulfamoyl)phenyl]boronic acid. InChIKey: KXZCLGBIAGNAGS-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [4-(propylsulfamoyl)phenyl]boronic acid |
| InChIKey | KXZCLGBIAGNAGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCC)(O)O |
Computed by PubChem (NCBI)