cas: 685126-86-7 — see every product listed under this CAS number, including other names
(5-Bromo-2-(trifluoromethoxy)phenyl)methanol, 97% (CAS 685126-86-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216965-100MG |
| cas | 685126-86-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 721.64 Pln | |
| Fluorochem | 250mg | 940.31 Pln | |
| Fluorochem | 500mg | 1507.82 Pln | |
| Fluorochem | 1g | 2226.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[5-bromo-2-(trifluoromethoxy)phenyl]methanol (CAS 685126-86-7) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [5-bromo-2-(trifluoromethoxy)phenyl]methanol. InChIKey: PMJMORZJWISOPJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [5-bromo-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | PMJMORZJWISOPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CO)OC(F)(F)F |
Computed by PubChem (NCBI)