CAS 1026201-95-5 appears in our catalog under these names: 3-Bromo-5-(trifluoromethoxy)benzyl alcohol, 95%, (3-Bromo-5-(trifluoromethoxy)phenyl)methanol, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
[3-bromo-5-(trifluoromethoxy)phenyl]methanol (CAS 1026201-95-5) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [3-bromo-5-(trifluoromethoxy)phenyl]methanol. InChIKey: CQQFETSXXFSLPO-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [3-bromo-5-(trifluoromethoxy)phenyl]methanol |
| InChIKey | CQQFETSXXFSLPO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)CO |
Computed by PubChem (NCBI)