CAS 1253189-03-5 appears in our catalog under these names: 2-Bromo-6-(trifluoromethoxy)benzyl alcohol, 98%, 2-Bromo-6-(trifluoromethoxy)benzyl alcohol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 2g.
[2-bromo-6-(trifluoromethoxy)phenyl]methanol (CAS 1253189-03-5) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [2-bromo-6-(trifluoromethoxy)phenyl]methanol. InChIKey: DTDOTSMDADDJEH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [2-bromo-6-(trifluoromethoxy)phenyl]methanol |
| InChIKey | DTDOTSMDADDJEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CO)OC(F)(F)F |
Computed by PubChem (NCBI)