CAS 685126-86-7 appears in our catalog under these names: 5-Bromo-2-(trifluoromethoxy)benzyl alcohol, 98%, (5-Bromo-2-(trifluoromethoxy),phenyl),methanol, 97%, 97%, (5-Bromo-2-(trifluoromethoxy)phenyl)methanol, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
[5-bromo-2-(trifluoromethoxy)phenyl]methanol (CAS 685126-86-7) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: [5-bromo-2-(trifluoromethoxy)phenyl]methanol. InChIKey: PMJMORZJWISOPJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | [5-bromo-2-(trifluoromethoxy)phenyl]methanol |
| InChIKey | PMJMORZJWISOPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CO)OC(F)(F)F |
Computed by PubChem (NCBI)