CAS 2137924-98-0 is the registry number for 5-Bromo-2-(2,2,2-trifluoro-1-hydroxyethyl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(2,2,2-trifluoro-1-hydroxyethyl)phenol (CAS 2137924-98-0) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoro-1-hydroxyethyl)phenol. InChIKey: QRAAXRQRXHPCDW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoro-1-hydroxyethyl)phenol |
| InChIKey | QRAAXRQRXHPCDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)O)C(C(F)(F)F)O |
Computed by PubChem (NCBI)