cas: 774608-50-3 — see every product listed under this CAS number, including other names
(5-Bromo-2-chlorophenyl)boronic acid, 98% (CAS 774608-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F437327-100MG |
| cas | 774608-50-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 393.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(5-bromo-2-chlorophenyl)boronic acid (CAS 774608-50-3) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)boronic acid. InChIKey: IWUGPRLLWXXECY-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)boronic acid |
| InChIKey | IWUGPRLLWXXECY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)Cl)(O)O |
Computed by PubChem (NCBI)