Products 1217501-18-2
CAS 1217501-18-2 appears in our catalog under these names: 2-Bromo-5-chlorophenylboronic acid 98%, 2-Bromo-5-chlorophenylboronic acid, 98%, 98%, (2-Bromo-5-chlorophenyl)boronic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2-bromo-5-chlorophenyl)boronic acid (CAS 1217501-18-2) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (2-bromo-5-chlorophenyl)boronic acid. InChIKey: ZWWJWGKFUCVGFU-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (2-bromo-5-chlorophenyl)boronic acid |
| InChIKey | ZWWJWGKFUCVGFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)