CAS 1451393-45-5 appears in our catalog under these names: (2-bromo-4-chlorophenyl)boronic acid, 95%, 2-Bromo-4-chlorophenylboronic acid, 95-<97%, 2-Bromo-4-chlorophenylboronic acid, ≥97-<99%, (2-Bromo-4-chlorophenyl)boronic acid 98%, (2-Bromo-4-chlorophenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 50g, 100g, 200g.
(2-bromo-4-chlorophenyl)boronic acid (CAS 1451393-45-5) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (2-bromo-4-chlorophenyl)boronic acid. InChIKey: GMMUCVGZXGOUNM-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (2-bromo-4-chlorophenyl)boronic acid |
| InChIKey | GMMUCVGZXGOUNM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)