Products 2414289-69-1
CAS 2414289-69-1 appears in our catalog under these names: (2-Bromo-3-chlorophenyl)boronic acid 98+%, (2-Bromo-3-chlorophenyl)boronic acid, 98+%, 98+%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-3-chlorophenyl)boronic acid (CAS 2414289-69-1) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (2-bromo-3-chlorophenyl)boronic acid. InChIKey: BWSYBOSDUYASEG-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (2-bromo-3-chlorophenyl)boronic acid |
| InChIKey | BWSYBOSDUYASEG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)Br)(O)O |
Computed by PubChem (NCBI)