CAS 1186403-17-7 appears in our catalog under these names: (3-Bromo-5-chlorophenyl)boronic acid 95%, (3-Bromo-5-chlorophenyl)boronic acid, 95%, 95%, (3-Bromo-5-chlorophenyl)boronic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
(3-bromo-5-chlorophenyl)boronic acid (CAS 1186403-17-7) is a chemical compound with the molecular formula C6H5BBrClO2 and a molecular weight of 235.27 g/mol. IUPAC name: (3-bromo-5-chlorophenyl)boronic acid. InChIKey: YLKZHZVQNASRAN-UHFFFAOYSA-N.
| Molecular formula | C6H5BBrClO2 |
|---|---|
| Molecular weight | 235.27 g/mol |
| IUPAC name | (3-bromo-5-chlorophenyl)boronic acid |
| InChIKey | YLKZHZVQNASRAN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)Cl)(O)O |
Computed by PubChem (NCBI)