(5-Bromo-2-methylphenyl)boronic acid, 98%
cas: 774608-13-8 — see every product listed under this CAS number, including other names
(5-Bromo-2-methylphenyl)boronic acid, 98% (CAS 774608-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F218391-100MG |
| cas | 774608-13-8 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 836.18 Pln | |
| Fluorochem | 5g | 2012.85 Pln | |
| Fluorochem | 10g | 3923.64 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 815.38 Pln | |
| Ambeed | 5g | 1950.12 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1413.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(5-bromo-2-methylphenyl)boronic acid (CAS 774608-13-8) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (5-bromo-2-methylphenyl)boronic acid. InChIKey: QOZFXELTNKMOQP-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (5-bromo-2-methylphenyl)boronic acid |
| InChIKey | QOZFXELTNKMOQP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)C)(O)O |
Computed by PubChem (NCBI)