(5-Bromo-2-methylphenyl)boronic acid, 98%
cas: 774608-13-8 — see every product listed under this CAS number, including other names
(5-Bromo-2-methylphenyl)boronic acid, 98% (CAS 774608-13-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218391-100MG |
| cas | 774608-13-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 1934.75 Pln | |
| Fluorochem | 10g | 3809.09 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(5-bromo-2-methylphenyl)boronic acid (CAS 774608-13-8) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (5-bromo-2-methylphenyl)boronic acid. InChIKey: QOZFXELTNKMOQP-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (5-bromo-2-methylphenyl)boronic acid |
| InChIKey | QOZFXELTNKMOQP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)C)(O)O |
Computed by PubChem (NCBI)