Products 851335-09-6
CAS 851335-09-6 appears in our catalog under these names: 4–Carboxy–2–chlorobenzeneboronic acid, 4-Carboxy-2-chlorophenylboronic Acid (contains varying amounts of Anhydride), 4-Carboxy-2-chlorophenylboronic acid 97%, 4-Carboxy-2-chlorophenylboronic acid, 97%, 97%, 4-Carboxy-2-chlorophenylboronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
4-borono-3-chlorobenzoic acid (CAS 851335-09-6) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: 4-borono-3-chlorobenzoic acid. InChIKey: FYDHSNLXZRGWFU-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | 4-borono-3-chlorobenzoic acid |
| InChIKey | FYDHSNLXZRGWFU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-borono-3-chlorobenzoic acid, 3-chloro-4-(dihydroxyboranyl)benzoic acid, simtuzumabum, SIMTUZUMAB [INN], Simtuzumab [USAN:INN], SIMTUZUMAB [USAN], SIMTUZUMAB [WHO-DD], Recombinant humanized anti-LOXL2 monoclonal antibody, 2-Chloro-4-carboxyphenylboronic acid, 4-Carboxy-2-chlorobenzeneboronic acid