CAS 2377608-88-1 is the registry number for (6-Chloro-2H-1,3-benzodioxol-5-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(6-chloro-1,3-benzodioxol-5-yl)boronic acid (CAS 2377608-88-1) is a chemical compound with the molecular formula C7H6BClO4 and a molecular weight of 200.38 g/mol. IUPAC name: (6-chloro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: QNZQIXCZUTZVOO-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO4 |
|---|---|
| Molecular weight | 200.38 g/mol |
| IUPAC name | (6-chloro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | QNZQIXCZUTZVOO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1Cl)OCO2)(O)O |
Computed by PubChem (NCBI)